johncg285 johncg285

03-03-2017
Mathematics

contestada

Find the sum. (6x2y + 4xy2 − 2y3 + 6) + (x2y + 3y3 − 5)

Respuesta :

Аноним Аноним

03-03-2017

The Answer that I got:

7x^y+4xy^+y^+1

The ^ to 7x^y = power of 2
The ^ to 4xy^ = power of 2
The ^ to y^+1 = power of 3

Answer Link

Otras preguntas

cosec(6b+pi/8)=sec(2b-pi/8)

what is the greatest common factor of the terms of the polynomial 12x^4 - 6x^3 + 9x^2

Which statement below is true only for homogeneous catalysts? a. A homogeneous catalyst is a solid substance to which liquid or gaseous reactants will adhere to

Where did imperialism happen

Solve for q. 20 − 3q = 5q − 20

What are four keys we grow as members of the church

How far away is Earth away from the sun?

If I know the area of a square is 676 ft^2 what is the length of the square

3/4, -7/10, -3/4, 8/10 least to greatest.

When we experience one sensation for an extended period of time, the receptor neurons stop firing and our body gets used to it. What is this called? Question 4