sarimanmaurice sarimanmaurice

01-09-2022
Mathematics

contestada

Activity calculate the mean of each set of numbers. a) 54,35, 27, 61, 38

Respuesta :

AnnieIsCool6480 AnnieIsCool6480

01-09-2022

Answer:

The Mean is 43

Step-by-step explanation:

If you need me to explain how I got there- I would be happy to ^w^

Answer Link

jimrgrant1 jimrgrant1

01-09-2022

Answer:

mean = 43

Step-by-step explanation:

the mean is calculated as

mean = [tex]\frac{sum}{count}[/tex] = [tex]\frac{54+35+27+61+38}{5}[/tex] = [tex]\frac{215}{5}[/tex] = 43

Answer Link

Otras preguntas

explain the uneven distribution of population in nepal?

Concentration measurements provide a quantitative measurement of the amount of solute that is dissolved in a given amount of solvent. True or false?

I need 5 differences between a citizen an alien

What is 16.92 x 8.4 how much is the sum.

this also 7th fgrade homework!!

what is the type of international trade

3. A ball was thrown into the air with an initial velocity of 72 feet per second. The height of the ball after t seconds is represented by the equation: h= -16t

cosec(6b+pi/8)=sec(2b-pi/8)

How do you change repeating decimals into percentages?

What graph would best represent acceleration as a function of mass when a constant force is applied? What graph would best represent acceleration as a function